C9H6Br2O2 — CID 166445962
5-bromo-6-[(Z)-2-bromoethenyl]-1,3-benzodioxole (PubChem CID 166445962) has the molecular formula C9H6Br2O2 and a molecular weight of 305.95 g/mol. Its IUPAC name is 5-bromo-6-[(Z)-2-bromoethenyl]-1,3-benzodioxole.
| Compound Name | 5-bromo-6-[(Z)-2-bromoethenyl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 166445962 |
| Molecular Formula | C9H6Br2O2 |
| Molecular Weight | 305.95 g/mol |
| Exact Mass | 303.87 |
| IUPAC Name | 5-bromo-6-[(Z)-2-bromoethenyl]-1,3-benzodioxole |
| SMILES | Br/C=C\c1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C9H6Br2O2/c10-2-1-6-3-8-9(4-7(6)11)13-5-12-8/h1-4H,5H2/b2-1- |
| InChIKey | JMYQYNHHKJPFMP-UPHRSURJSA-N |
| XLogP | 3.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.95 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |