C15H12BrNO3 — CID 88567097
(E)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-phenylmethoxymethanimine (PubChem CID 88567097) has the molecular formula C15H12BrNO3 and a molecular weight of 334.17 g/mol. Its IUPAC name is (E)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-phenylmethoxymethanimine.
| Compound Name | (E)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-phenylmethoxymethanimine |
|---|---|
| PubChem CID | 88567097 |
| Molecular Formula | C15H12BrNO3 |
| Molecular Weight | 334.17 g/mol |
| Exact Mass | 333.00 |
| IUPAC Name | (E)-1-(6-bromo-1,3-benzodioxol-5-yl)-N-phenylmethoxymethanimine |
| SMILES | Brc1cc2c(cc1/C=N/OCc1ccccc1)OCO2 |
| InChI | InChI=1S/C15H12BrNO3/c16-13-7-15-14(18-10-19-15)6-12(13)8-17-20-9-11-4-2-1-3-5-11/h1-8H,9-10H2/b17-8+ |
| InChIKey | DFJHQSUQBBJFFY-CAOOACKPSA-N |
| XLogP | 3.73 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.17 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|