C18H22N2O3 — CID 145492731
ethane;N-methyl-6-[(E)-phenylmethoxyiminomethyl]-1,3-benzodioxol-5-amine (PubChem CID 145492731) has the molecular formula C18H22N2O3 and a molecular weight of 314.39 g/mol. Its IUPAC name is ethane;N-methyl-6-[(E)-phenylmethoxyiminomethyl]-1,3-benzodioxol-5-amine.
| Compound Name | ethane;N-methyl-6-[(E)-phenylmethoxyiminomethyl]-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 145492731 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | ethane;N-methyl-6-[(E)-phenylmethoxyiminomethyl]-1,3-benzodioxol-5-amine |
| SMILES | CC.CNc1cc2c(cc1/C=N/OCc1ccccc1)OCO2 |
| InChI | InChI=1S/C16H16N2O3.C2H6/c1-17-14-8-16-15(19-11-20-16)7-13(14)9-18-21-10-12-5-3-2-4-6-12;1-2/h2-9,17H,10-11H2,1H3;1-2H3/b18-9+; |
| InChIKey | LRAGXCWYJRLJSB-WUBZALIBSA-N |
| XLogP | 4.03 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|