C17H15Br2NO2 — CID 10598453
(E)-2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-bromophenyl)-N,N-dimethylethenamine (PubChem CID 10598453) has the molecular formula C17H15Br2NO2 and a molecular weight of 425.12 g/mol. Its IUPAC name is (E)-2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-bromophenyl)-N,N-dimethylethenamine.
| Compound Name | (E)-2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-bromophenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 10598453 |
| Molecular Formula | C17H15Br2NO2 |
| Molecular Weight | 425.12 g/mol |
| Exact Mass | 422.95 |
| IUPAC Name | (E)-2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-bromophenyl)-N,N-dimethylethenamine |
| SMILES | CN(C)/C(=C/c1cc2c(cc1Br)OCO2)c1ccccc1Br |
| InChI | InChI=1S/C17H15Br2NO2/c1-20(2)15(12-5-3-4-6-13(12)18)7-11-8-16-17(9-14(11)19)22-10-21-16/h3-9H,10H2,1-2H3/b15-7+ |
| InChIKey | PPZPTURWXPWQMX-VIZOYTHASA-N |
| XLogP | 5.00 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.12 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|