C17H9BrN2O2S — CID 3125365
2-(1,3-benzothiazol-2-yl)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile (PubChem CID 3125365) has the molecular formula C17H9BrN2O2S and a molecular weight of 385.24 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-yl)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-yl)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3125365 |
| Molecular Formula | C17H9BrN2O2S |
| Molecular Weight | 385.24 g/mol |
| Exact Mass | 383.96 |
| IUPAC Name | 2-(1,3-benzothiazol-2-yl)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc2c(cc1Br)OCO2)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H9BrN2O2S/c18-12-7-15-14(21-9-22-15)6-10(12)5-11(8-19)17-20-13-3-1-2-4-16(13)23-17/h1-7H,9H2 |
| InChIKey | XFWSNCDPIPJQMK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.24 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|