C17H9F3N2S — CID 7791432
(E)-2-(1,3-benzothiazol-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 7791432) has the molecular formula C17H9F3N2S and a molecular weight of 330.33 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 7791432 |
| Molecular Formula | C17H9F3N2S |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-yl)-3-[2-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccccc1C(F)(F)F)c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H9F3N2S/c18-17(19,20)13-6-2-1-5-11(13)9-12(10-21)16-22-14-7-3-4-8-15(14)23-16/h1-9H/b12-9+ |
| InChIKey | AUJYYFWGOZRKLW-FMIVXFBMSA-N |
| XLogP | 5.38 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|