C20H23Br2NO4 — CID 10696748
(E)-1,2-bis(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylethenamine (PubChem CID 10696748) has the molecular formula C20H23Br2NO4 and a molecular weight of 501.22 g/mol. Its IUPAC name is (E)-1,2-bis(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylethenamine.
| Compound Name | (E)-1,2-bis(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 10696748 |
| Molecular Formula | C20H23Br2NO4 |
| Molecular Weight | 501.22 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | (E)-1,2-bis(2-bromo-4,5-dimethoxyphenyl)-N,N-dimethylethenamine |
| SMILES | COc1cc(Br)c(/C=C(\c2cc(OC)c(OC)cc2Br)N(C)C)cc1OC |
| InChI | InChI=1S/C20H23Br2NO4/c1-23(2)16(13-9-18(25-4)20(27-6)11-15(13)22)7-12-8-17(24-3)19(26-5)10-14(12)21/h7-11H,1-6H3/b16-7+ |
| InChIKey | WLVNQONTBDDEMC-FRKPEAEDSA-N |
| XLogP | 5.31 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.22 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|