C20H19BrO6 — CID 67756121
methyl 2-[1-(2-bromo-4,5-dimethoxyphenyl)-3-methoxy-3-oxoprop-1-en-2-yl]benzoate (PubChem CID 67756121) has the molecular formula C20H19BrO6 and a molecular weight of 435.27 g/mol. Its IUPAC name is methyl 2-[1-(2-bromo-4,5-dimethoxyphenyl)-3-methoxy-3-oxoprop-1-en-2-yl]benzoate.
| Compound Name | methyl 2-[1-(2-bromo-4,5-dimethoxyphenyl)-3-methoxy-3-oxoprop-1-en-2-yl]benzoate |
|---|---|
| PubChem CID | 67756121 |
| Molecular Formula | C20H19BrO6 |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.04 |
| IUPAC Name | methyl 2-[1-(2-bromo-4,5-dimethoxyphenyl)-3-methoxy-3-oxoprop-1-en-2-yl]benzoate |
| SMILES | COC(=O)C(=Cc1cc(OC)c(OC)cc1Br)c1ccccc1C(=O)OC |
| InChI | InChI=1S/C20H19BrO6/c1-24-17-10-12(16(21)11-18(17)25-2)9-15(20(23)27-4)13-7-5-6-8-14(13)19(22)26-3/h5-11H,1-4H3 |
| InChIKey | QCNZSWPKUFLYOA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|