C12H13BrO4 — CID 83959400
(E)-3-(2-bromo-4,5-dimethoxyphenyl)but-2-enoic acid (PubChem CID 83959400) has the molecular formula C12H13BrO4 and a molecular weight of 301.14 g/mol. Its IUPAC name is (E)-3-(2-bromo-4,5-dimethoxyphenyl)but-2-enoic acid.
| Compound Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)but-2-enoic acid |
|---|---|
| PubChem CID | 83959400 |
| Molecular Formula | C12H13BrO4 |
| Molecular Weight | 301.14 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | (E)-3-(2-bromo-4,5-dimethoxyphenyl)but-2-enoic acid |
| SMILES | COc1cc(Br)c(/C(C)=C/C(=O)O)cc1OC |
| InChI | InChI=1S/C12H13BrO4/c1-7(4-12(14)15)8-5-10(16-2)11(17-3)6-9(8)13/h4-6H,1-3H3,(H,14,15)/b7-4+ |
| InChIKey | YWJPMSMTIHPXHG-QPJJXVBHSA-N |
| XLogP | 2.95 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.14 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|