C15H10BrClO3 — CID 86101978
2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-chlorophenyl)ethanone (PubChem CID 86101978) has the molecular formula C15H10BrClO3 and a molecular weight of 353.60 g/mol. Its IUPAC name is 2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-chlorophenyl)ethanone.
| Compound Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-chlorophenyl)ethanone |
|---|---|
| PubChem CID | 86101978 |
| Molecular Formula | C15H10BrClO3 |
| Molecular Weight | 353.60 g/mol |
| Exact Mass | 351.95 |
| IUPAC Name | 2-(6-bromo-1,3-benzodioxol-5-yl)-1-(2-chlorophenyl)ethanone |
| SMILES | O=C(Cc1cc2c(cc1Br)OCO2)c1ccccc1Cl |
| InChI | InChI=1S/C15H10BrClO3/c16-11-7-15-14(19-8-20-15)6-9(11)5-13(18)10-3-1-2-4-12(10)17/h1-4,6-7H,5,8H2 |
| InChIKey | KUTGIUQEHUIQJR-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.60 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |