C22H19BrN2O3 — CID 16573647
N-benzyl-2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]benzamide (PubChem CID 16573647) has the molecular formula C22H19BrN2O3 and a molecular weight of 439.31 g/mol. Its IUPAC name is N-benzyl-2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]benzamide.
| Compound Name | N-benzyl-2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 16573647 |
| Molecular Formula | C22H19BrN2O3 |
| Molecular Weight | 439.31 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-benzyl-2-[(6-bromo-1,3-benzodioxol-5-yl)methylamino]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccccc1NCc1cc2c(cc1Br)OCO2 |
| InChI | InChI=1S/C22H19BrN2O3/c23-18-11-21-20(27-14-28-21)10-16(18)13-24-19-9-5-4-8-17(19)22(26)25-12-15-6-2-1-3-7-15/h1-11,24H,12-14H2,(H,25,26) |
| InChIKey | VGAODXKLYZMBKT-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |