C26H24N2O3 — CID 9347720
N-benzyl-2-[(6,7-dimethyl-2-oxochromen-4-yl)methylamino]benzamide (PubChem CID 9347720) has the molecular formula C26H24N2O3 and a molecular weight of 412.49 g/mol. Its IUPAC name is N-benzyl-2-[(6,7-dimethyl-2-oxochromen-4-yl)methylamino]benzamide.
| Compound Name | N-benzyl-2-[(6,7-dimethyl-2-oxochromen-4-yl)methylamino]benzamide |
|---|---|
| PubChem CID | 9347720 |
| Molecular Formula | C26H24N2O3 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-benzyl-2-[(6,7-dimethyl-2-oxochromen-4-yl)methylamino]benzamide |
| SMILES | Cc1cc2oc(=O)cc(CNc3ccccc3C(=O)NCc3ccccc3)c2cc1C |
| InChI | InChI=1S/C26H24N2O3/c1-17-12-22-20(14-25(29)31-24(22)13-18(17)2)16-27-23-11-7-6-10-21(23)26(30)28-15-19-8-4-3-5-9-19/h3-14,27H,15-16H2,1-2H3,(H,28,30) |
| InChIKey | DOPRLXFMCFQYHM-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|