C17H13NO6 — CID 54047991
2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylamino]benzoic acid (PubChem CID 54047991) has the molecular formula C17H13NO6 and a molecular weight of 327.29 g/mol. Its IUPAC name is 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylamino]benzoic acid.
| Compound Name | 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylamino]benzoic acid |
|---|---|
| PubChem CID | 54047991 |
| Molecular Formula | C17H13NO6 |
| Molecular Weight | 327.29 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | 2-[(6,7-dihydroxy-2-oxochromen-4-yl)methylamino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NCc1cc(=O)oc2cc(O)c(O)cc12 |
| InChI | InChI=1S/C17H13NO6/c19-13-6-11-9(5-16(21)24-15(11)7-14(13)20)8-18-12-4-2-1-3-10(12)17(22)23/h1-7,18-20H,8H2,(H,22,23) |
| InChIKey | LQWYBACAWVJINV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.29 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|