C26H30N2O4 — CID 60536693
4-[[2-(3-hydroxypiperidine-1-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 60536693) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 4-[[2-(3-hydroxypiperidine-1-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[2-(3-hydroxypiperidine-1-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 60536693 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 4-[[2-(3-hydroxypiperidine-1-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNc3ccccc3C(=O)N3CCCC(O)C3)c2cc1C(C)C |
| InChI | InChI=1S/C26H30N2O4/c1-16(2)21-13-22-18(12-25(30)32-24(22)11-17(21)3)14-27-23-9-5-4-8-20(23)26(31)28-10-6-7-19(29)15-28/h4-5,8-9,11-13,16,19,27,29H,6-7,10,14-15H2,1-3H3 |
| InChIKey | ACAYEKQTBIOGCR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 82.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|