C27H32N2O4 — CID 60538799
4-[[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 60538799) has the molecular formula C27H32N2O4 and a molecular weight of 448.56 g/mol. Its IUPAC name is 4-[[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 60538799 |
| Molecular Formula | C27H32N2O4 |
| Molecular Weight | 448.56 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 4-[[4-(2,6-dimethylmorpholine-4-carbonyl)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNc3ccc(C(=O)N4CC(C)OC(C)C4)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C27H32N2O4/c1-16(2)23-12-24-21(11-26(30)33-25(24)10-17(23)3)13-28-22-8-6-20(7-9-22)27(31)29-14-18(4)32-19(5)15-29/h6-12,16,18-19,28H,13-15H2,1-5H3 |
| InChIKey | PSCJNHHFUMNLRA-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|