C21H21F2NO3 — CID 134062843
4-[[4-(difluoromethoxy)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 134062843) has the molecular formula C21H21F2NO3 and a molecular weight of 373.40 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[[4-(difluoromethoxy)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 134062843 |
| Molecular Formula | C21H21F2NO3 |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | 4-[[4-(difluoromethoxy)anilino]methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNc3ccc(OC(F)F)cc3)c2cc1C(C)C |
| InChI | InChI=1S/C21H21F2NO3/c1-12(2)17-10-18-14(9-20(25)27-19(18)8-13(17)3)11-24-15-4-6-16(7-5-15)26-21(22)23/h4-10,12,21,24H,11H2,1-3H3 |
| InChIKey | AWIXAUFDYNTSKF-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|