C22H24ClNO4 — CID 7516697
4-[(4-chloro-2,5-dimethoxyanilino)methyl]-7-methyl-6-propan-2-ylchromen-2-one (PubChem CID 7516697) has the molecular formula C22H24ClNO4 and a molecular weight of 401.89 g/mol. Its IUPAC name is 4-[(4-chloro-2,5-dimethoxyanilino)methyl]-7-methyl-6-propan-2-ylchromen-2-one.
| Compound Name | 4-[(4-chloro-2,5-dimethoxyanilino)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 7516697 |
| Molecular Formula | C22H24ClNO4 |
| Molecular Weight | 401.89 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-[(4-chloro-2,5-dimethoxyanilino)methyl]-7-methyl-6-propan-2-ylchromen-2-one |
| SMILES | COc1cc(NCc2cc(=O)oc3cc(C)c(C(C)C)cc23)c(OC)cc1Cl |
| InChI | InChI=1S/C22H24ClNO4/c1-12(2)15-8-16-14(7-22(25)28-19(16)6-13(15)3)11-24-18-10-20(26-4)17(23)9-21(18)27-5/h6-10,12,24H,11H2,1-5H3 |
| InChIKey | USGGTSBVZZITQF-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.89 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|