C19H21NO2S — CID 9265816
7-methyl-6-propan-2-yl-4-[(thiophen-2-ylmethylamino)methyl]chromen-2-one (PubChem CID 9265816) has the molecular formula C19H21NO2S and a molecular weight of 327.45 g/mol. Its IUPAC name is 7-methyl-6-propan-2-yl-4-[(thiophen-2-ylmethylamino)methyl]chromen-2-one.
| Compound Name | 7-methyl-6-propan-2-yl-4-[(thiophen-2-ylmethylamino)methyl]chromen-2-one |
|---|---|
| PubChem CID | 9265816 |
| Molecular Formula | C19H21NO2S |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 7-methyl-6-propan-2-yl-4-[(thiophen-2-ylmethylamino)methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNCc3cccs3)c2cc1C(C)C |
| InChI | InChI=1S/C19H21NO2S/c1-12(2)16-9-17-14(10-20-11-15-5-4-6-23-15)8-19(21)22-18(17)7-13(16)3/h4-9,12,20H,10-11H2,1-3H3 |
| InChIKey | UUAIEAWUTZNYJO-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|