C25H36N2O3 — CID 9255988
7-methyl-4-[[(1-morpholin-4-ylcyclohexyl)methylamino]methyl]-6-propan-2-ylchromen-2-one (PubChem CID 9255988) has the molecular formula C25H36N2O3 and a molecular weight of 412.57 g/mol. Its IUPAC name is 7-methyl-4-[[(1-morpholin-4-ylcyclohexyl)methylamino]methyl]-6-propan-2-ylchromen-2-one.
| Compound Name | 7-methyl-4-[[(1-morpholin-4-ylcyclohexyl)methylamino]methyl]-6-propan-2-ylchromen-2-one |
|---|---|
| PubChem CID | 9255988 |
| Molecular Formula | C25H36N2O3 |
| Molecular Weight | 412.57 g/mol |
| Exact Mass | 412.27 |
| IUPAC Name | 7-methyl-4-[[(1-morpholin-4-ylcyclohexyl)methylamino]methyl]-6-propan-2-ylchromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CNCC3(N4CCOCC4)CCCCC3)c2cc1C(C)C |
| InChI | InChI=1S/C25H36N2O3/c1-18(2)21-15-22-20(14-24(28)30-23(22)13-19(21)3)16-26-17-25(7-5-4-6-8-25)27-9-11-29-12-10-27/h13-15,18,26H,4-12,16-17H2,1-3H3 |
| InChIKey | IKDAPYUVSILUPA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|