C20H25NO4 — CID 97005010
methyl (2S)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]pyrrolidine-2-carboxylate (PubChem CID 97005010) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is methyl (2S)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]pyrrolidine-2-carboxylate.
| Compound Name | methyl (2S)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 97005010 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | methyl (2S)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]pyrrolidine-2-carboxylate |
| SMILES | COC(=O)[C@@H]1CCCN1Cc1cc(=O)oc2cc(C)c(C(C)C)cc12 |
| InChI | InChI=1S/C20H25NO4/c1-12(2)15-10-16-14(9-19(22)25-18(16)8-13(15)3)11-21-7-5-6-17(21)20(23)24-4/h8-10,12,17H,5-7,11H2,1-4H3/t17-/m0/s1 |
| InChIKey | GWXOBAPIOUIAOK-KRWDZBQOSA-N |
| XLogP | 3.36 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|