C22H29NO4 — CID 4261789
ethyl 1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidine-3-carboxylate (PubChem CID 4261789) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is ethyl 1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 4261789 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | ethyl 1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(Cc2cc(=O)oc3cc(C)c(C(C)C)cc23)C1 |
| InChI | InChI=1S/C22H29NO4/c1-5-26-22(25)16-7-6-8-23(12-16)13-17-10-21(24)27-20-9-15(4)18(14(2)3)11-19(17)20/h9-11,14,16H,5-8,12-13H2,1-4H3 |
| InChIKey | IQQGGSNCZZANSZ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|