C22H30NO4+ — CID 2463919
ethyl (3R)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidin-1-ium-3-carboxylate (PubChem CID 2463919) has the molecular formula C22H30NO4+ and a molecular weight of 372.49 g/mol. Its IUPAC name is ethyl (3R)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidin-1-ium-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 2463919 |
| Molecular Formula | C22H30NO4+ |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | ethyl (3R)-1-[(7-methyl-2-oxo-6-propan-2-ylchromen-4-yl)methyl]piperidin-1-ium-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCC[NH+](Cc2cc(=O)oc3cc(C)c(C(C)C)cc23)C1 |
| InChI | InChI=1S/C22H29NO4/c1-5-26-22(25)16-7-6-8-23(12-16)13-17-10-21(24)27-20-9-15(4)18(14(2)3)11-19(17)20/h9-11,14,16H,5-8,12-13H2,1-4H3/p+1/t16-/m1/s1 |
| InChIKey | IQQGGSNCZZANSZ-MRXNPFEDSA-O |
| XLogP | 2.58 |
| TPSA | 60.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|