C23H29ClN2O5 — CID 30833944
2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide (PubChem CID 30833944) has the molecular formula C23H29ClN2O5 and a molecular weight of 448.95 g/mol. Its IUPAC name is 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide.
| Compound Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
|---|---|
| PubChem CID | 30833944 |
| Molecular Formula | C23H29ClN2O5 |
| Molecular Weight | 448.95 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-(6-chloro-4-methyl-2-oxochromen-7-yl)oxy-N-[(1-morpholin-4-ylcyclohexyl)methyl]acetamide |
| SMILES | Cc1cc(=O)oc2cc(OCC(=O)NCC3(N4CCOCC4)CCCCC3)c(Cl)cc12 |
| InChI | InChI=1S/C23H29ClN2O5/c1-16-11-22(28)31-19-13-20(18(24)12-17(16)19)30-14-21(27)25-15-23(5-3-2-4-6-23)26-7-9-29-10-8-26/h11-13H,2-10,14-15H2,1H3,(H,25,27) |
| InChIKey | CIBPCJYSMZPASJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.95 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|