C26H30N2O3 — CID 35209077
6,7-dimethyl-4-[[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]methyl]chromen-2-one (PubChem CID 35209077) has the molecular formula C26H30N2O3 and a molecular weight of 418.54 g/mol. Its IUPAC name is 6,7-dimethyl-4-[[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]methyl]chromen-2-one.
| Compound Name | 6,7-dimethyl-4-[[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]methyl]chromen-2-one |
|---|---|
| PubChem CID | 35209077 |
| Molecular Formula | C26H30N2O3 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 6,7-dimethyl-4-[[4-(4-propan-2-ylbenzoyl)piperazin-1-yl]methyl]chromen-2-one |
| SMILES | Cc1cc2oc(=O)cc(CN3CCN(C(=O)c4ccc(C(C)C)cc4)CC3)c2cc1C |
| InChI | InChI=1S/C26H30N2O3/c1-17(2)20-5-7-21(8-6-20)26(30)28-11-9-27(10-12-28)16-22-15-25(29)31-24-14-19(4)18(3)13-23(22)24/h5-8,13-15,17H,9-12,16H2,1-4H3 |
| InChIKey | BYTKGFYTRPWBMI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|