C24H26FN3O — CID 33216209
[4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone (PubChem CID 33216209) has the molecular formula C24H26FN3O and a molecular weight of 391.49 g/mol. Its IUPAC name is [4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone.
| Compound Name | [4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
|---|---|
| PubChem CID | 33216209 |
| Molecular Formula | C24H26FN3O |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | [4-[(6-fluoroquinolin-8-yl)methyl]piperazin-1-yl]-(4-propan-2-ylphenyl)methanone |
| SMILES | CC(C)c1ccc(C(=O)N2CCN(Cc3cc(F)cc4cccnc34)CC2)cc1 |
| InChI | InChI=1S/C24H26FN3O/c1-17(2)18-5-7-19(8-6-18)24(29)28-12-10-27(11-13-28)16-21-15-22(25)14-20-4-3-9-26-23(20)21/h3-9,14-15,17H,10-13,16H2,1-2H3 |
| InChIKey | XPBWVUFBSDLTSJ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |