C25H28N2O5 — CID 32578944
4-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one (PubChem CID 32578944) has the molecular formula C25H28N2O5 and a molecular weight of 436.51 g/mol. Its IUPAC name is 4-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one.
| Compound Name | 4-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
|---|---|
| PubChem CID | 32578944 |
| Molecular Formula | C25H28N2O5 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 4-[[4-(3,4-dimethoxybenzoyl)piperazin-1-yl]methyl]-6,7-dimethylchromen-2-one |
| SMILES | COc1ccc(C(=O)N2CCN(Cc3cc(=O)oc4cc(C)c(C)cc34)CC2)cc1OC |
| InChI | InChI=1S/C25H28N2O5/c1-16-11-20-19(14-24(28)32-22(20)12-17(16)2)15-26-7-9-27(10-8-26)25(29)18-5-6-21(30-3)23(13-18)31-4/h5-6,11-14H,7-10,15H2,1-4H3 |
| InChIKey | WEJUYPUVGQQART-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 72.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|