C14H13NO4S — CID 82894049
2-[[5-(carboxymethyl)thiophen-2-yl]methylamino]benzoic acid (PubChem CID 82894049) has the molecular formula C14H13NO4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[[5-(carboxymethyl)thiophen-2-yl]methylamino]benzoic acid.
| Compound Name | 2-[[5-(carboxymethyl)thiophen-2-yl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 82894049 |
| Molecular Formula | C14H13NO4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-[[5-(carboxymethyl)thiophen-2-yl]methylamino]benzoic acid |
| SMILES | O=C(O)Cc1ccc(CNc2ccccc2C(=O)O)s1 |
| InChI | InChI=1S/C14H13NO4S/c16-13(17)7-9-5-6-10(20-9)8-15-12-4-2-1-3-11(12)14(18)19/h1-6,15H,7-8H2,(H,16,17)(H,18,19) |
| InChIKey | UBCOKVBVSNZEHM-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |