C12H11FN2O2S — CID 116812779
2-[5-[[(6-fluoro-2-pyridinyl)amino]methyl]thiophen-2-yl]acetic acid (PubChem CID 116812779) has the molecular formula C12H11FN2O2S and a molecular weight of 266.30 g/mol. Its IUPAC name is 2-[5-[[(6-fluoro-2-pyridinyl)amino]methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[[(6-fluoro-2-pyridinyl)amino]methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 116812779 |
| Molecular Formula | C12H11FN2O2S |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 2-[5-[[(6-fluoro-2-pyridinyl)amino]methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNc2cccc(F)n2)s1 |
| InChI | InChI=1S/C12H11FN2O2S/c13-10-2-1-3-11(15-10)14-7-9-5-4-8(18-9)6-12(16)17/h1-5H,6-7H2,(H,14,15)(H,16,17) |
| InChIKey | RCWKNQWDPYDKKB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|