C13H16FN3S — CID 116812815
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-6-fluoropyridin-2-amine (PubChem CID 116812815) has the molecular formula C13H16FN3S and a molecular weight of 265.36 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-6-fluoropyridin-2-amine.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-6-fluoropyridin-2-amine |
|---|---|
| PubChem CID | 116812815 |
| Molecular Formula | C13H16FN3S |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-6-fluoropyridin-2-amine |
| SMILES | CC(C)(C)c1ncc(CNc2cccc(F)n2)s1 |
| InChI | InChI=1S/C13H16FN3S/c1-13(2,3)12-16-8-9(18-12)7-15-11-6-4-5-10(14)17-11/h4-6,8H,7H2,1-3H3,(H,15,17) |
| InChIKey | VKMZAPBOMSNYFL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|