C16H21FN2OS — CID 115593197
N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4-ethoxy-3-fluoroaniline (PubChem CID 115593197) has the molecular formula C16H21FN2OS and a molecular weight of 308.42 g/mol. Its IUPAC name is N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4-ethoxy-3-fluoroaniline.
| Compound Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4-ethoxy-3-fluoroaniline |
|---|---|
| PubChem CID | 115593197 |
| Molecular Formula | C16H21FN2OS |
| Molecular Weight | 308.42 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | N-[(2-tert-butyl-1,3-thiazol-5-yl)methyl]-4-ethoxy-3-fluoroaniline |
| SMILES | CCOc1ccc(NCc2cnc(C(C)(C)C)s2)cc1F |
| InChI | InChI=1S/C16H21FN2OS/c1-5-20-14-7-6-11(8-13(14)17)18-9-12-10-19-15(21-12)16(2,3)4/h6-8,10,18H,5,9H2,1-4H3 |
| InChIKey | MQYCMKGJEFGUQS-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.42 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|