C14H18N2O2S — CID 54880114
[2-ethoxy-5-[(2-methyl-1,3-thiazol-5-yl)methylamino]phenyl]methanol (PubChem CID 54880114) has the molecular formula C14H18N2O2S and a molecular weight of 278.38 g/mol. Its IUPAC name is [2-ethoxy-5-[(2-methyl-1,3-thiazol-5-yl)methylamino]phenyl]methanol.
| Compound Name | [2-ethoxy-5-[(2-methyl-1,3-thiazol-5-yl)methylamino]phenyl]methanol |
|---|---|
| PubChem CID | 54880114 |
| Molecular Formula | C14H18N2O2S |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | [2-ethoxy-5-[(2-methyl-1,3-thiazol-5-yl)methylamino]phenyl]methanol |
| SMILES | CCOc1ccc(NCc2cnc(C)s2)cc1CO |
| InChI | InChI=1S/C14H18N2O2S/c1-3-18-14-5-4-12(6-11(14)9-17)16-8-13-7-15-10(2)19-13/h4-7,16-17H,3,8-9H2,1-2H3 |
| InChIKey | NMTMYYVIEFQCSH-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|