C17H21N3O2S — CID 110897388
[5-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]-2-ethoxyphenyl]methanol (PubChem CID 110897388) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is [5-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]-2-ethoxyphenyl]methanol.
| Compound Name | [5-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]-2-ethoxyphenyl]methanol |
|---|---|
| PubChem CID | 110897388 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [5-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]-2-ethoxyphenyl]methanol |
| SMILES | CCOc1ccc(NCc2c(C)nc3sc(C)cn23)cc1CO |
| InChI | InChI=1S/C17H21N3O2S/c1-4-22-16-6-5-14(7-13(16)10-21)18-8-15-12(3)19-17-20(15)9-11(2)23-17/h5-7,9,18,21H,4,8,10H2,1-3H3 |
| InChIKey | CALFXLTYGXLPPS-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 58.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|