2-(1,3-thiazol-2-ylmethylamino)benzoic acid

C11H10N2O2S — CID 62231705

IUPAC2-(1,3-thiazol-2-ylmethylamino)benzoic acid
SMILESO=C(O)c1ccccc1NCc1nccs1
InChIInChI=1S/C11H10N2O2S/c14-11(15)8-3-1-2-4-9(8)13-7-10-12-5-6-16-10/h1-6,13H,7H2,(H,14,15)
InChIKeyHKGDVVVMCNUIPL-UHFFFAOYSA-N
MW234.28 g/mol
LogP2.45
Rot. Bonds4

About 2-(1,3-thiazol-2-ylmethylamino)benzoic acid

2-(1,3-thiazol-2-ylmethylamino)benzoic acid (PubChem CID 62231705) has the molecular formula C11H10N2O2S and a molecular weight of 234.28 g/mol. Its IUPAC name is 2-(1,3-thiazol-2-ylmethylamino)benzoic acid.

Molecular Properties

Compound Name2-(1,3-thiazol-2-ylmethylamino)benzoic acid
PubChem CID62231705
Molecular FormulaC11H10N2O2S
Molecular Weight234.28 g/mol
Exact Mass234.05
IUPAC Name2-(1,3-thiazol-2-ylmethylamino)benzoic acid
SMILESO=C(O)c1ccccc1NCc1nccs1
InChIInChI=1S/C11H10N2O2S/c14-11(15)8-3-1-2-4-9(8)13-7-10-12-5-6-16-10/h1-6,13H,7H2,(H,14,15)
InChIKeyHKGDVVVMCNUIPL-UHFFFAOYSA-N
XLogP2.45
TPSA62.22 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.28
LogP ≤ 52.45
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1,3-thiazol-2-ylmethylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,3-thiazol-2-ylmethylamino)benzoic acid?
The IUPAC name of 2-(1,3-thiazol-2-ylmethylamino)benzoic acid (CID 62231705) is 2-(1,3-thiazol-2-ylmethylamino)benzoic acid.
What is the SMILES notation for 2-(1,3-thiazol-2-ylmethylamino)benzoic acid?
The canonical SMILES for 2-(1,3-thiazol-2-ylmethylamino)benzoic acid is O=C(O)c1ccccc1NCc1nccs1.
What is the InChIKey of 2-(1,3-thiazol-2-ylmethylamino)benzoic acid?
The InChIKey is HKGDVVVMCNUIPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O2S/c14-11(15)8-3-1-2-4-9(8)13-7-10-12-5-6-16-10/h1-6,13H,7H2,(H,14,15).
What are the key properties of 2-(1,3-thiazol-2-ylmethylamino)benzoic acid?
2-(1,3-thiazol-2-ylmethylamino)benzoic acid has a molecular weight of 234.28 g/mol, XLogP of 2.45, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-thiazol-2-ylmethylamino)benzoic acid is sourced from PubChem (CID 62231705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).