C14H11N3O2S — CID 106766776
1-(1,3-thiazol-2-ylmethylamino)isoquinoline-4-carboxylic acid (PubChem CID 106766776) has the molecular formula C14H11N3O2S and a molecular weight of 285.33 g/mol. Its IUPAC name is 1-(1,3-thiazol-2-ylmethylamino)isoquinoline-4-carboxylic acid.
| Compound Name | 1-(1,3-thiazol-2-ylmethylamino)isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106766776 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 1-(1,3-thiazol-2-ylmethylamino)isoquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cnc(NCc2nccs2)c2ccccc12 |
| InChI | InChI=1S/C14H11N3O2S/c18-14(19)11-7-16-13(10-4-2-1-3-9(10)11)17-8-12-15-5-6-20-12/h1-7H,8H2,(H,16,17)(H,18,19) |
| InChIKey | OVTKRKAWQJLLII-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 75.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |