C10H8N2O3 — CID 106767395
1-(hydroxyamino)isoquinoline-4-carboxylic acid (PubChem CID 106767395) has the molecular formula C10H8N2O3 and a molecular weight of 204.19 g/mol. Its IUPAC name is 1-(hydroxyamino)isoquinoline-4-carboxylic acid.
| Compound Name | 1-(hydroxyamino)isoquinoline-4-carboxylic acid |
|---|---|
| PubChem CID | 106767395 |
| Molecular Formula | C10H8N2O3 |
| Molecular Weight | 204.19 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | 1-(hydroxyamino)isoquinoline-4-carboxylic acid |
| SMILES | O=C(O)c1cnc(NO)c2ccccc12 |
| InChI | InChI=1S/C10H8N2O3/c13-10(14)8-5-11-9(12-15)7-4-2-1-3-6(7)8/h1-5,15H,(H,11,12)(H,13,14) |
| InChIKey | DGBUVQAJOHKTTK-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|