C9H8N4O2S — CID 62709979
3-(1,3-thiazol-2-ylmethylamino)pyrazine-2-carboxylic acid (PubChem CID 62709979) has the molecular formula C9H8N4O2S and a molecular weight of 236.26 g/mol. Its IUPAC name is 3-(1,3-thiazol-2-ylmethylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(1,3-thiazol-2-ylmethylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 62709979 |
| Molecular Formula | C9H8N4O2S |
| Molecular Weight | 236.26 g/mol |
| Exact Mass | 236.04 |
| IUPAC Name | 3-(1,3-thiazol-2-ylmethylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NCc1nccs1 |
| InChI | InChI=1S/C9H8N4O2S/c14-9(15)7-8(12-2-1-11-7)13-5-6-10-3-4-16-6/h1-4H,5H2,(H,12,13)(H,14,15) |
| InChIKey | QMXVSRZGQJNKJE-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |