C12H12N6S2 — CID 86794222
2-N,3-N-bis(1,3-thiazol-2-ylmethyl)pyrazine-2,3-diamine (PubChem CID 86794222) has the molecular formula C12H12N6S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 2-N,3-N-bis(1,3-thiazol-2-ylmethyl)pyrazine-2,3-diamine.
| Compound Name | 2-N,3-N-bis(1,3-thiazol-2-ylmethyl)pyrazine-2,3-diamine |
|---|---|
| PubChem CID | 86794222 |
| Molecular Formula | C12H12N6S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 2-N,3-N-bis(1,3-thiazol-2-ylmethyl)pyrazine-2,3-diamine |
| SMILES | c1csc(CNc2nccnc2NCc2nccs2)n1 |
| InChI | InChI=1S/C12H12N6S2/c1-2-16-12(18-8-10-14-4-6-20-10)11(15-1)17-7-9-13-3-5-19-9/h1-6H,7-8H2,(H,15,17)(H,16,18) |
| InChIKey | DCDDDPSEJPDFGC-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |