C6H8N6S — CID 63150079
1-methyl-N-(1,3-thiazol-2-ylmethyl)tetrazol-5-amine (PubChem CID 63150079) has the molecular formula C6H8N6S and a molecular weight of 196.24 g/mol. Its IUPAC name is 1-methyl-N-(1,3-thiazol-2-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(1,3-thiazol-2-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 63150079 |
| Molecular Formula | C6H8N6S |
| Molecular Weight | 196.24 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 1-methyl-N-(1,3-thiazol-2-ylmethyl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NCc1nccs1 |
| InChI | InChI=1S/C6H8N6S/c1-12-6(9-10-11-12)8-4-5-7-2-3-13-5/h2-3H,4H2,1H3,(H,8,9,11) |
| InChIKey | FZMMXYJPCVQLGJ-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |