C8H10N6 — CID 18801252
1-methyl-N-(pyridin-3-ylmethyl)tetrazol-5-amine (PubChem CID 18801252) has the molecular formula C8H10N6 and a molecular weight of 190.21 g/mol. Its IUPAC name is 1-methyl-N-(pyridin-3-ylmethyl)tetrazol-5-amine.
| Compound Name | 1-methyl-N-(pyridin-3-ylmethyl)tetrazol-5-amine |
|---|---|
| PubChem CID | 18801252 |
| Molecular Formula | C8H10N6 |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 1-methyl-N-(pyridin-3-ylmethyl)tetrazol-5-amine |
| SMILES | Cn1nnnc1NCc1cccnc1 |
| InChI | InChI=1S/C8H10N6/c1-14-8(11-12-13-14)10-6-7-3-2-4-9-5-7/h2-5H,6H2,1H3,(H,10,11,13) |
| InChIKey | KZVHMYMCXQENLV-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |