C9H9N3S — CID 61285050
N-(1,3-thiazol-2-ylmethyl)pyridin-4-amine (PubChem CID 61285050) has the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. Its IUPAC name is N-(1,3-thiazol-2-ylmethyl)pyridin-4-amine.
| Compound Name | N-(1,3-thiazol-2-ylmethyl)pyridin-4-amine |
|---|---|
| PubChem CID | 61285050 |
| Molecular Formula | C9H9N3S |
| Molecular Weight | 191.26 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | N-(1,3-thiazol-2-ylmethyl)pyridin-4-amine |
| SMILES | c1cc(NCc2nccs2)ccn1 |
| InChI | InChI=1S/C9H9N3S/c1-3-10-4-2-8(1)12-7-9-11-5-6-13-9/h1-6H,7H2,(H,10,12) |
| InChIKey | IYHMMBCZAZGOES-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |