C11H13N3S — CID 81406357
(1S)-1-pyridin-4-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 81406357) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is (1S)-1-pyridin-4-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | (1S)-1-pyridin-4-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 81406357 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (1S)-1-pyridin-4-yl-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | C[C@H](NCc1nccs1)c1ccncc1 |
| InChI | InChI=1S/C11H13N3S/c1-9(10-2-4-12-5-3-10)14-8-11-13-6-7-15-11/h2-7,9,14H,8H2,1H3/t9-/m0/s1 |
| InChIKey | BNAYTCHVXROFKE-VIFPVBQESA-N |
| XLogP | 2.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |