C12H13FN2S — CID 61284818
1-(4-fluorophenyl)-N-(1,3-thiazol-2-ylmethyl)ethanamine (PubChem CID 61284818) has the molecular formula C12H13FN2S and a molecular weight of 236.31 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(1,3-thiazol-2-ylmethyl)ethanamine.
| Compound Name | 1-(4-fluorophenyl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
|---|---|
| PubChem CID | 61284818 |
| Molecular Formula | C12H13FN2S |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.08 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(1,3-thiazol-2-ylmethyl)ethanamine |
| SMILES | CC(NCc1nccs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C12H13FN2S/c1-9(10-2-4-11(13)5-3-10)15-8-12-14-6-7-16-12/h2-7,9,15H,8H2,1H3 |
| InChIKey | KYYZIROJKJXJIL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |