C8H7ClN4S — CID 79556675
5-chloro-N-(1,3-thiazol-2-ylmethyl)pyrimidin-2-amine (PubChem CID 79556675) has the molecular formula C8H7ClN4S and a molecular weight of 226.69 g/mol. Its IUPAC name is 5-chloro-N-(1,3-thiazol-2-ylmethyl)pyrimidin-2-amine.
| Compound Name | 5-chloro-N-(1,3-thiazol-2-ylmethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 79556675 |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 g/mol |
| Exact Mass | 226.01 |
| IUPAC Name | 5-chloro-N-(1,3-thiazol-2-ylmethyl)pyrimidin-2-amine |
| SMILES | Clc1cnc(NCc2nccs2)nc1 |
| InChI | InChI=1S/C8H7ClN4S/c9-6-3-11-8(12-4-6)13-5-7-10-1-2-14-7/h1-4H,5H2,(H,11,12,13) |
| InChIKey | RMEPAXGKBBVMPV-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |