C13H16N2OS — CID 63656225
4-propoxy-N-(1,3-thiazol-2-ylmethyl)aniline (PubChem CID 63656225) has the molecular formula C13H16N2OS and a molecular weight of 248.35 g/mol. Its IUPAC name is 4-propoxy-N-(1,3-thiazol-2-ylmethyl)aniline.
| Compound Name | 4-propoxy-N-(1,3-thiazol-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 63656225 |
| Molecular Formula | C13H16N2OS |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 4-propoxy-N-(1,3-thiazol-2-ylmethyl)aniline |
| SMILES | CCCOc1ccc(NCc2nccs2)cc1 |
| InChI | InChI=1S/C13H16N2OS/c1-2-8-16-12-5-3-11(4-6-12)15-10-13-14-7-9-17-13/h3-7,9,15H,2,8,10H2,1H3 |
| InChIKey | UPJIVNVABKKDHJ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|