C17H16F2N2OS — CID 19439326
N-[(5,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-propoxyaniline (PubChem CID 19439326) has the molecular formula C17H16F2N2OS and a molecular weight of 334.39 g/mol. Its IUPAC name is N-[(5,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-propoxyaniline.
| Compound Name | N-[(5,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-propoxyaniline |
|---|---|
| PubChem CID | 19439326 |
| Molecular Formula | C17H16F2N2OS |
| Molecular Weight | 334.39 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | N-[(5,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-propoxyaniline |
| SMILES | CCCOc1ccc(NCc2nc3cc(F)cc(F)c3s2)cc1 |
| InChI | InChI=1S/C17H16F2N2OS/c1-2-7-22-13-5-3-12(4-6-13)20-10-16-21-15-9-11(18)8-14(19)17(15)23-16/h3-6,8-9,20H,2,7,10H2,1H3 |
| InChIKey | PVMCLIMYKMEXCW-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.39 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|