C15H12F2N2S — CID 19439543
N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-methylaniline (PubChem CID 19439543) has the molecular formula C15H12F2N2S and a molecular weight of 290.34 g/mol. Its IUPAC name is N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-methylaniline.
| Compound Name | N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-methylaniline |
|---|---|
| PubChem CID | 19439543 |
| Molecular Formula | C15H12F2N2S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | N-[(6,7-difluoro-1,3-benzothiazol-2-yl)methyl]-4-methylaniline |
| SMILES | Cc1ccc(NCc2nc3ccc(F)c(F)c3s2)cc1 |
| InChI | InChI=1S/C15H12F2N2S/c1-9-2-4-10(5-3-9)18-8-13-19-12-7-6-11(16)14(17)15(12)20-13/h2-7,18H,8H2,1H3 |
| InChIKey | GQGOUBVOGPAKHS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |