C16H15BrN2S — CID 79533516
N-[2-(6-bromo-1,3-benzothiazol-2-yl)ethyl]-4-methylaniline (PubChem CID 79533516) has the molecular formula C16H15BrN2S and a molecular weight of 347.28 g/mol. Its IUPAC name is N-[2-(6-bromo-1,3-benzothiazol-2-yl)ethyl]-4-methylaniline.
| Compound Name | N-[2-(6-bromo-1,3-benzothiazol-2-yl)ethyl]-4-methylaniline |
|---|---|
| PubChem CID | 79533516 |
| Molecular Formula | C16H15BrN2S |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 346.01 |
| IUPAC Name | N-[2-(6-bromo-1,3-benzothiazol-2-yl)ethyl]-4-methylaniline |
| SMILES | Cc1ccc(NCCc2nc3ccc(Br)cc3s2)cc1 |
| InChI | InChI=1S/C16H15BrN2S/c1-11-2-5-13(6-3-11)18-9-8-16-19-14-7-4-12(17)10-15(14)20-16/h2-7,10,18H,8-9H2,1H3 |
| InChIKey | SDKJTMVVVWYOCC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |