5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid

C12H12BrNO2S — CID 79533588

IUPAC5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid
SMILESO=C(O)CCCCc1nc2ccc(Br)cc2s1
InChIInChI=1S/C12H12BrNO2S/c13-8-5-6-9-10(7-8)17-11(14-9)3-1-2-4-12(15)16/h5-7H,1-4H2,(H,15,16)
InChIKeyZJTDHOOBELXXRD-UHFFFAOYSA-N
MW314.20 g/mol
LogP3.86
Rot. Bonds5

About 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid

5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid (PubChem CID 79533588) has the molecular formula C12H12BrNO2S and a molecular weight of 314.20 g/mol. Its IUPAC name is 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid.

Molecular Properties

Compound Name5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid
PubChem CID79533588
Molecular FormulaC12H12BrNO2S
Molecular Weight314.20 g/mol
Exact Mass312.98
IUPAC Name5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid
SMILESO=C(O)CCCCc1nc2ccc(Br)cc2s1
InChIInChI=1S/C12H12BrNO2S/c13-8-5-6-9-10(7-8)17-11(14-9)3-1-2-4-12(15)16/h5-7H,1-4H2,(H,15,16)
InChIKeyZJTDHOOBELXXRD-UHFFFAOYSA-N
XLogP3.86
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500314.20
LogP ≤ 53.86
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid?
The IUPAC name of 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid (CID 79533588) is 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid.
What is the SMILES notation for 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid?
The canonical SMILES for 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid is O=C(O)CCCCc1nc2ccc(Br)cc2s1.
What is the InChIKey of 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid?
The InChIKey is ZJTDHOOBELXXRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BrNO2S/c13-8-5-6-9-10(7-8)17-11(14-9)3-1-2-4-12(15)16/h5-7H,1-4H2,(H,15,16).
What are the key properties of 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid?
5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid has a molecular weight of 314.20 g/mol, XLogP of 3.86, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(6-bromo-1,3-benzothiazol-2-yl)pentanoic acid is sourced from PubChem (CID 79533588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).