C10H9N5O2 — CID 106897804
3-(pyridazin-3-ylmethylamino)pyrazine-2-carboxylic acid (PubChem CID 106897804) has the molecular formula C10H9N5O2 and a molecular weight of 231.22 g/mol. Its IUPAC name is 3-(pyridazin-3-ylmethylamino)pyrazine-2-carboxylic acid.
| Compound Name | 3-(pyridazin-3-ylmethylamino)pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 106897804 |
| Molecular Formula | C10H9N5O2 |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | 3-(pyridazin-3-ylmethylamino)pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1nccnc1NCc1cccnn1 |
| InChI | InChI=1S/C10H9N5O2/c16-10(17)8-9(12-5-4-11-8)13-6-7-2-1-3-14-15-7/h1-5H,6H2,(H,12,13)(H,16,17) |
| InChIKey | HWZGAYXYYVWACI-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |