C13H10BrCl2NO2S — CID 107787381
2-[5-[(4-bromo-2,3-dichloroanilino)methyl]thiophen-2-yl]acetic acid (PubChem CID 107787381) has the molecular formula C13H10BrCl2NO2S and a molecular weight of 395.11 g/mol. Its IUPAC name is 2-[5-[(4-bromo-2,3-dichloroanilino)methyl]thiophen-2-yl]acetic acid.
| Compound Name | 2-[5-[(4-bromo-2,3-dichloroanilino)methyl]thiophen-2-yl]acetic acid |
|---|---|
| PubChem CID | 107787381 |
| Molecular Formula | C13H10BrCl2NO2S |
| Molecular Weight | 395.11 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 2-[5-[(4-bromo-2,3-dichloroanilino)methyl]thiophen-2-yl]acetic acid |
| SMILES | O=C(O)Cc1ccc(CNc2ccc(Br)c(Cl)c2Cl)s1 |
| InChI | InChI=1S/C13H10BrCl2NO2S/c14-9-3-4-10(13(16)12(9)15)17-6-8-2-1-7(20-8)5-11(18)19/h1-4,17H,5-6H2,(H,18,19) |
| InChIKey | XKZGDWKOZNRBLV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.11 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|